C11H22N4O6 — CID 160740452
(2S)-2,6-diamino-6-oxohexanoic acid;(2S)-2,5-diamino-5-oxopentanoic acid (PubChem CID 160740452) has the molecular formula C11H22N4O6 and a molecular weight of 306.32 g/mol. Its IUPAC name is (2S)-2,6-diamino-6-oxohexanoic acid;(2S)-2,5-diamino-5-oxopentanoic acid.
| Compound Name | (2S)-2,6-diamino-6-oxohexanoic acid;(2S)-2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 160740452 |
| Molecular Formula | C11H22N4O6 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2S)-2,6-diamino-6-oxohexanoic acid;(2S)-2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CCC[C@H](N)C(=O)O.NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H12N2O3.C5H10N2O3/c7-4(6(10)11)2-1-3-5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,7H2,(H2,8,9)(H,10,11);3H,1-2,6H2,(H2,7,8)(H,9,10)/t4-;3-/m00/s1 |
| InChIKey | RVMVJJWLZWUYTC-WOYAITHZSA-N |
| XLogP | -2.28 |
| TPSA | 212.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |