2,5-diamino-5-oxopentanoic acid

C5H10N2O3 — CID 738

IUPAC2,5-diamino-5-oxopentanoic acid
SMILESNC(=O)CCC(N)C(=O)O
InChIInChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)
InChIKeyZDXPYRJPNDTMRX-UHFFFAOYSA-N
MW146.15 g/mol
LogP-1.34
Rot. Bonds4

About 2,5-diamino-5-oxopentanoic acid

2,5-diamino-5-oxopentanoic acid (PubChem CID 738) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is 2,5-diamino-5-oxopentanoic acid.

Molecular Properties

Compound Name2,5-diamino-5-oxopentanoic acid
PubChem CID738
Molecular FormulaC5H10N2O3
Molecular Weight146.15 g/mol
Exact Mass146.07
IUPAC Name2,5-diamino-5-oxopentanoic acid
SMILESNC(=O)CCC(N)C(=O)O
InChIInChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)
InChIKeyZDXPYRJPNDTMRX-UHFFFAOYSA-N
XLogP-1.34
TPSA106.41 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.15
LogP ≤ 5-1.34
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,5-diamino-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-diamino-5-oxopentanoic acid?
The IUPAC name of 2,5-diamino-5-oxopentanoic acid (CID 738) is 2,5-diamino-5-oxopentanoic acid.
What is the SMILES notation for 2,5-diamino-5-oxopentanoic acid?
The canonical SMILES for 2,5-diamino-5-oxopentanoic acid is NC(=O)CCC(N)C(=O)O.
What is the InChIKey of 2,5-diamino-5-oxopentanoic acid?
The InChIKey is ZDXPYRJPNDTMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10).
What are the key properties of 2,5-diamino-5-oxopentanoic acid?
2,5-diamino-5-oxopentanoic acid has a molecular weight of 146.15 g/mol, XLogP of -1.34, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diamino-5-oxopentanoic acid is sourced from PubChem (CID 738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).