C5H10N2O3 — CID 87103617
2,5-bis(15N)(azanyl)-5-oxopentanoic acid (PubChem CID 87103617) has the molecular formula C5H10N2O3 and a molecular weight of 148.13 g/mol. Its IUPAC name is 2,5-bis(15N)(azanyl)-5-oxopentanoic acid.
| Compound Name | 2,5-bis(15N)(azanyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87103617 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2,5-bis(15N)(azanyl)-5-oxopentanoic acid |
| SMILES | [15NH2]C(=O)CCC([15NH2])C(=O)O |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/i6+1,7+1 |
| InChIKey | ZDXPYRJPNDTMRX-AKZCFXPHSA-N |
| XLogP | -1.34 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |