C10H22N4O7S — CID 22595067
2-aminoacetic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid (PubChem CID 22595067) has the molecular formula C10H22N4O7S and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-aminoacetic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid.
| Compound Name | 2-aminoacetic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22595067 |
| Molecular Formula | C10H22N4O7S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-aminoacetic acid;2-amino-3-sulfanylpropanoic acid;2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)O.NC(CS)C(=O)O.NCC(=O)O |
| InChI | InChI=1S/C5H10N2O3.C3H7NO2S.C2H5NO2/c6-3(5(9)10)1-2-4(7)8;4-2(1-7)3(5)6;3-1-2(4)5/h3H,1-2,6H2,(H2,7,8)(H,9,10);2,7H,1,4H2,(H,5,6);1,3H2,(H,4,5) |
| InChIKey | PWCXAMXVGIBFCV-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 233.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|