About (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid
(2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid (PubChem CID 87266348) has the molecular formula C6H14N2O4S2
and a molecular weight of 242.32 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid |
| PubChem CID | 87266348 |
| Molecular Formula | C6H14N2O4S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid |
| SMILES | NC(CS)C(=O)O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/2C3H7NO2S/c2*4-2(1-7)3(5)6/h2*2,7H,1,4H2,(H,5,6)/t2-;/m0./s1 |
| InChIKey | YVOOPGWEIRIUOX-DKWTVANSSA-N |
| XLogP | -1.34 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid?
The IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid (CID 87266348) is (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid.
What is the SMILES notation for (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid?
The canonical SMILES for (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid is NC(CS)C(=O)O.N[C@@H](CS)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid?
The InChIKey is YVOOPGWEIRIUOX-DKWTVANSSA-N. The full InChI is InChI=1S/2C3H7NO2S/c2*4-2(1-7)3(5)6/h2*2,7H,1,4H2,(H,5,6)/t2-;/m0./s1.
What are the key properties of (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid?
(2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid has a molecular weight of 242.32 g/mol, XLogP of -1.34, 4 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-sulfanylpropanoic acid;2-amino-3-sulfanylpropanoic acid is sourced from PubChem (CID 87266348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).