About (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride
(2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride (PubChem CID 87203931) has the molecular formula C4H12ClNO2S
and a molecular weight of 173.66 g/mol. Its IUPAC name is (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride |
| PubChem CID | 87203931 |
| Molecular Formula | C4H12ClNO2S |
| Molecular Weight | 173.66 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride |
| SMILES | C.Cl.N[C@H](CS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S.CH4.ClH/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H4;1H/t2-;;/m1../s1 |
| InChIKey | AIPBOISHJYKMLN-YBBRRFGFSA-N |
| XLogP | 0.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.66 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride?
The IUPAC name of (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride (CID 87203931) is (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride.
What is the SMILES notation for (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride?
The canonical SMILES for (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride is C.Cl.N[C@H](CS)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride?
The InChIKey is AIPBOISHJYKMLN-YBBRRFGFSA-N. The full InChI is InChI=1S/C3H7NO2S.CH4.ClH/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H4;1H/t2-;;/m1../s1.
What are the key properties of (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride?
(2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride has a molecular weight of 173.66 g/mol, XLogP of 0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-sulfanylpropanoic acid;methane;hydrochloride is sourced from PubChem (CID 87203931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).