C6H18Cl2N2O2S — CID 174907487
2-amino-3-sulfanylpropanoic acid;N,N-dimethylmethanamine;dihydrochloride (PubChem CID 174907487) has the molecular formula C6H18Cl2N2O2S and a molecular weight of 253.19 g/mol. Its IUPAC name is 2-amino-3-sulfanylpropanoic acid;N,N-dimethylmethanamine;dihydrochloride.
| Compound Name | 2-amino-3-sulfanylpropanoic acid;N,N-dimethylmethanamine;dihydrochloride |
|---|---|
| PubChem CID | 174907487 |
| Molecular Formula | C6H18Cl2N2O2S |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-amino-3-sulfanylpropanoic acid;N,N-dimethylmethanamine;dihydrochloride |
| SMILES | CN(C)C.Cl.Cl.NC(CS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S.C3H9N.2ClH/c4-2(1-7)3(5)6;1-4(2)3;;/h2,7H,1,4H2,(H,5,6);1-3H3;2*1H |
| InChIKey | TVXUGFBVVDWBIJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|