About zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-)
zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) (PubChem CID 157249919) has the molecular formula C3H7NO3SZn
and a molecular weight of 202.55 g/mol. Its IUPAC name is zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-).
Molecular Properties
| Compound Name | zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) |
| PubChem CID | 157249919 |
| Molecular Formula | C3H7NO3SZn |
| Molecular Weight | 202.55 g/mol |
| Exact Mass | 200.94 |
| IUPAC Name | zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) |
| SMILES | N[C@@H](CS)C(=O)O.[O-2].[Zn+2] |
| InChI | InChI=1S/C3H7NO2S.O.Zn/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);;/q;-2;+2/t2-;;/m0../s1 |
| InChIKey | FTJFXJNWTMQYAT-JIZZDEOASA-N |
| XLogP | -0.79 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.55 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-)?
The IUPAC name of zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) (CID 157249919) is zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-).
What is the SMILES notation for zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-)?
The canonical SMILES for zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) is N[C@@H](CS)C(=O)O.[O-2].[Zn+2].
What is the InChIKey of zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-)?
The InChIKey is FTJFXJNWTMQYAT-JIZZDEOASA-N. The full InChI is InChI=1S/C3H7NO2S.O.Zn/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);;/q;-2;+2/t2-;;/m0../s1.
What are the key properties of zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-)?
zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) has a molecular weight of 202.55 g/mol, XLogP of -0.79, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;(2R)-2-amino-3-sulfanylpropanoic acid;oxygen(2-) is sourced from PubChem (CID 157249919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).