C4H7CaNO5S — CID 161349060
calcium;(2R)-2-amino-3-sulfanylpropanoic acid;carbonate (PubChem CID 161349060) has the molecular formula C4H7CaNO5S and a molecular weight of 221.25 g/mol. Its IUPAC name is calcium;(2R)-2-amino-3-sulfanylpropanoic acid;carbonate.
| Compound Name | calcium;(2R)-2-amino-3-sulfanylpropanoic acid;carbonate |
|---|---|
| PubChem CID | 161349060 |
| Molecular Formula | C4H7CaNO5S |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 220.97 |
| IUPAC Name | calcium;(2R)-2-amino-3-sulfanylpropanoic acid;carbonate |
| SMILES | N[C@@H](CS)C(=O)O.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C3H7NO2S.CH2O3.Ca/c4-2(1-7)3(5)6;2-1(3)4;/h2,7H,1,4H2,(H,5,6);(H2,2,3,4);/q;;+2/p-2/t2-;;/m0../s1 |
| InChIKey | AVCYCYYADQUPAC-JIZZDEOASA-L |
| XLogP | -3.50 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|