About (2R)-2-amino-3-sulfanylpropanoic acid;iron
(2R)-2-amino-3-sulfanylpropanoic acid;iron (PubChem CID 87142909) has the molecular formula C3H7FeNO2S
and a molecular weight of 177.01 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;iron.
Molecular Properties
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;iron |
| PubChem CID | 87142909 |
| Molecular Formula | C3H7FeNO2S |
| Molecular Weight | 177.01 g/mol |
| Exact Mass | 176.95 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;iron |
| SMILES | N[C@@H](CS)C(=O)O.[Fe] |
| InChI | InChI=1S/C3H7NO2S.Fe/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);/t2-;/m0./s1 |
| InChIKey | WPQSNMCKACDGEG-DKWTVANSSA-N |
| XLogP | -0.67 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.01 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-sulfanylpropanoic acid;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;iron?
The IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;iron (CID 87142909) is (2R)-2-amino-3-sulfanylpropanoic acid;iron.
What is the SMILES notation for (2R)-2-amino-3-sulfanylpropanoic acid;iron?
The canonical SMILES for (2R)-2-amino-3-sulfanylpropanoic acid;iron is N[C@@H](CS)C(=O)O.[Fe].
What is the InChIKey of (2R)-2-amino-3-sulfanylpropanoic acid;iron?
The InChIKey is WPQSNMCKACDGEG-DKWTVANSSA-N. The full InChI is InChI=1S/C3H7NO2S.Fe/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);/t2-;/m0./s1.
What are the key properties of (2R)-2-amino-3-sulfanylpropanoic acid;iron?
(2R)-2-amino-3-sulfanylpropanoic acid;iron has a molecular weight of 177.01 g/mol, XLogP of -0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-sulfanylpropanoic acid;iron is sourced from PubChem (CID 87142909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).