About 2-oxononadecanedioic acid
2-oxononadecanedioic acid (PubChem CID 19882771) has the molecular formula C19H34O5
and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-oxononadecanedioic acid.
Molecular Properties
| Compound Name | 2-oxononadecanedioic acid |
| PubChem CID | 19882771 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-oxononadecanedioic acid |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C19H34O5/c20-17(19(23)24)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22/h1-16H2,(H,21,22)(H,23,24) |
| InChIKey | REDKGGVVSGHQRJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxononadecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxononadecanedioic acid?
The IUPAC name of 2-oxononadecanedioic acid (CID 19882771) is 2-oxononadecanedioic acid.
What is the SMILES notation for 2-oxononadecanedioic acid?
The canonical SMILES for 2-oxononadecanedioic acid is O=C(O)CCCCCCCCCCCCCCCCC(=O)C(=O)O.
What is the InChIKey of 2-oxononadecanedioic acid?
The InChIKey is REDKGGVVSGHQRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O5/c20-17(19(23)24)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22/h1-16H2,(H,21,22)(H,23,24).
What are the key properties of 2-oxononadecanedioic acid?
2-oxononadecanedioic acid has a molecular weight of 342.48 g/mol, XLogP of 4.97, 18 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxononadecanedioic acid is sourced from PubChem (CID 19882771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).