About 9-aminopentadecanoic acid
9-aminopentadecanoic acid (PubChem CID 87304604) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 9-aminopentadecanoic acid.
Molecular Properties
| Compound Name | 9-aminopentadecanoic acid |
| PubChem CID | 87304604 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 9-aminopentadecanoic acid |
| SMILES | CCCCCCC(N)CCCCCCCC(=O)O |
| InChI | InChI=1S/C15H31NO2/c1-2-3-4-8-11-14(16)12-9-6-5-7-10-13-15(17)18/h14H,2-13,16H2,1H3,(H,17,18) |
| InChIKey | DXACPVOADGKGLG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-aminopentadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-aminopentadecanoic acid?
The IUPAC name of 9-aminopentadecanoic acid (CID 87304604) is 9-aminopentadecanoic acid.
What is the SMILES notation for 9-aminopentadecanoic acid?
The canonical SMILES for 9-aminopentadecanoic acid is CCCCCCC(N)CCCCCCCC(=O)O.
What is the InChIKey of 9-aminopentadecanoic acid?
The InChIKey is DXACPVOADGKGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-2-3-4-8-11-14(16)12-9-6-5-7-10-13-15(17)18/h14H,2-13,16H2,1H3,(H,17,18).
What are the key properties of 9-aminopentadecanoic acid?
9-aminopentadecanoic acid has a molecular weight of 257.42 g/mol, XLogP of 4.10, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-aminopentadecanoic acid is sourced from PubChem (CID 87304604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).