About 4-aminoicosanoic acid
4-aminoicosanoic acid (PubChem CID 57269724) has the molecular formula C20H41NO2
and a molecular weight of 327.55 g/mol. Its IUPAC name is 4-aminoicosanoic acid.
Molecular Properties
| Compound Name | 4-aminoicosanoic acid |
| PubChem CID | 57269724 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | 4-aminoicosanoic acid |
| SMILES | CCCCCCCCCCCCCCCCC(N)CCC(=O)O |
| InChI | InChI=1S/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21)17-18-20(22)23/h19H,2-18,21H2,1H3,(H,22,23) |
| InChIKey | DGGCCJMQANSXOL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminoicosanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminoicosanoic acid?
The IUPAC name of 4-aminoicosanoic acid (CID 57269724) is 4-aminoicosanoic acid.
What is the SMILES notation for 4-aminoicosanoic acid?
The canonical SMILES for 4-aminoicosanoic acid is CCCCCCCCCCCCCCCCC(N)CCC(=O)O.
What is the InChIKey of 4-aminoicosanoic acid?
The InChIKey is DGGCCJMQANSXOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21)17-18-20(22)23/h19H,2-18,21H2,1H3,(H,22,23).
What are the key properties of 4-aminoicosanoic acid?
4-aminoicosanoic acid has a molecular weight of 327.55 g/mol, XLogP of 6.05, 18 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminoicosanoic acid is sourced from PubChem (CID 57269724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).