About pentacosan-7-amine
pentacosan-7-amine (PubChem CID 88938409) has the molecular formula C25H53N
and a molecular weight of 367.71 g/mol. Its IUPAC name is pentacosan-7-amine.
Molecular Properties
| Compound Name | pentacosan-7-amine |
| PubChem CID | 88938409 |
| Molecular Formula | C25H53N |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.42 |
| IUPAC Name | pentacosan-7-amine |
| SMILES | CCCCCCCCCCCCCCCCCCC(N)CCCCCC |
| InChI | InChI=1S/C25H53N/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-25(26)23-21-8-6-4-2/h25H,3-24,26H2,1-2H3 |
| InChIKey | FIJKNDLIEVWBBO-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentacosan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacosan-7-amine?
The IUPAC name of pentacosan-7-amine (CID 88938409) is pentacosan-7-amine.
What is the SMILES notation for pentacosan-7-amine?
The canonical SMILES for pentacosan-7-amine is CCCCCCCCCCCCCCCCCCC(N)CCCCCC.
What is the InChIKey of pentacosan-7-amine?
The InChIKey is FIJKNDLIEVWBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H53N/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-22-24-25(26)23-21-8-6-4-2/h25H,3-24,26H2,1-2H3.
What are the key properties of pentacosan-7-amine?
pentacosan-7-amine has a molecular weight of 367.71 g/mol, XLogP of 8.94, 22 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentacosan-7-amine is sourced from PubChem (CID 88938409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).