About (4R)-tridecan-4-amine
(4R)-tridecan-4-amine (PubChem CID 150614684) has the molecular formula C13H29N
and a molecular weight of 199.38 g/mol. Its IUPAC name is (4R)-tridecan-4-amine.
Molecular Properties
| Compound Name | (4R)-tridecan-4-amine |
| PubChem CID | 150614684 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | (4R)-tridecan-4-amine |
| SMILES | CCCCCCCCC[C@H](N)CCC |
| InChI | InChI=1S/C13H29N/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h13H,3-12,14H2,1-2H3/t13-/m1/s1 |
| InChIKey | IUQGZYGLKCXJNY-CYBMUJFWSA-N |
| XLogP | 4.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-tridecan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-tridecan-4-amine?
The IUPAC name of (4R)-tridecan-4-amine (CID 150614684) is (4R)-tridecan-4-amine.
What is the SMILES notation for (4R)-tridecan-4-amine?
The canonical SMILES for (4R)-tridecan-4-amine is CCCCCCCCC[C@H](N)CCC.
What is the InChIKey of (4R)-tridecan-4-amine?
The InChIKey is IUQGZYGLKCXJNY-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H29N/c1-3-5-6-7-8-9-10-12-13(14)11-4-2/h13H,3-12,14H2,1-2H3/t13-/m1/s1.
What are the key properties of (4R)-tridecan-4-amine?
(4R)-tridecan-4-amine has a molecular weight of 199.38 g/mol, XLogP of 4.25, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-tridecan-4-amine is sourced from PubChem (CID 150614684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).