C20H45N3 — CID 88870264
icosane-5,10,16-triamine (PubChem CID 88870264) has the molecular formula C20H45N3 and a molecular weight of 327.60 g/mol. Its IUPAC name is icosane-5,10,16-triamine.
| Compound Name | icosane-5,10,16-triamine |
|---|---|
| PubChem CID | 88870264 |
| Molecular Formula | C20H45N3 |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.36 |
| IUPAC Name | icosane-5,10,16-triamine |
| SMILES | CCCCC(N)CCCCCC(N)CCCCC(N)CCCC |
| InChI | InChI=1S/C20H45N3/c1-3-5-12-18(21)14-8-7-9-15-20(23)17-11-10-16-19(22)13-6-4-2/h18-20H,3-17,21-23H2,1-2H3 |
| InChIKey | LACMVSKZQQSNNV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|