About octadecan-9-amine;hydrochloride
octadecan-9-amine;hydrochloride (PubChem CID 19002510) has the molecular formula C18H40ClN
and a molecular weight of 305.98 g/mol. Its IUPAC name is octadecan-9-amine;hydrochloride.
Molecular Properties
| Compound Name | octadecan-9-amine;hydrochloride |
| PubChem CID | 19002510 |
| Molecular Formula | C18H40ClN |
| Molecular Weight | 305.98 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | octadecan-9-amine;hydrochloride |
| SMILES | CCCCCCCCCC(N)CCCCCCCC.Cl |
| InChI | InChI=1S/C18H39N.ClH/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2;/h18H,3-17,19H2,1-2H3;1H |
| InChIKey | UKSNONZNPOSKFX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.98 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecan-9-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecan-9-amine;hydrochloride?
The IUPAC name of octadecan-9-amine;hydrochloride (CID 19002510) is octadecan-9-amine;hydrochloride.
What is the SMILES notation for octadecan-9-amine;hydrochloride?
The canonical SMILES for octadecan-9-amine;hydrochloride is CCCCCCCCCC(N)CCCCCCCC.Cl.
What is the InChIKey of octadecan-9-amine;hydrochloride?
The InChIKey is UKSNONZNPOSKFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N.ClH/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2;/h18H,3-17,19H2,1-2H3;1H.
What are the key properties of octadecan-9-amine;hydrochloride?
octadecan-9-amine;hydrochloride has a molecular weight of 305.98 g/mol, XLogP of 6.63, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadecan-9-amine;hydrochloride is sourced from PubChem (CID 19002510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).