About nonadecane-1,13-diamine
nonadecane-1,13-diamine (PubChem CID 102135569) has the molecular formula C19H42N2
and a molecular weight of 298.56 g/mol. Its IUPAC name is nonadecane-1,13-diamine.
Molecular Properties
| Compound Name | nonadecane-1,13-diamine |
| PubChem CID | 102135569 |
| Molecular Formula | C19H42N2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.33 |
| IUPAC Name | nonadecane-1,13-diamine |
| SMILES | CCCCCCC(N)CCCCCCCCCCCCN |
| InChI | InChI=1S/C19H42N2/c1-2-3-4-13-16-19(21)17-14-11-9-7-5-6-8-10-12-15-18-20/h19H,2-18,20-21H2,1H3 |
| InChIKey | YRVPGJPJYUDDDG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonadecane-1,13-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadecane-1,13-diamine?
The IUPAC name of nonadecane-1,13-diamine (CID 102135569) is nonadecane-1,13-diamine.
What is the SMILES notation for nonadecane-1,13-diamine?
The canonical SMILES for nonadecane-1,13-diamine is CCCCCCC(N)CCCCCCCCCCCCN.
What is the InChIKey of nonadecane-1,13-diamine?
The InChIKey is YRVPGJPJYUDDDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42N2/c1-2-3-4-13-16-19(21)17-14-11-9-7-5-6-8-10-12-15-18-20/h19H,2-18,20-21H2,1H3.
What are the key properties of nonadecane-1,13-diamine?
nonadecane-1,13-diamine has a molecular weight of 298.56 g/mol, XLogP of 5.53, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonadecane-1,13-diamine is sourced from PubChem (CID 102135569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).