About dodecan-1-amine;dodecan-2-amine
dodecan-1-amine;dodecan-2-amine (PubChem CID 88815564) has the molecular formula C24H54N2
and a molecular weight of 370.71 g/mol. Its IUPAC name is dodecan-1-amine;dodecan-2-amine.
Molecular Properties
| Compound Name | dodecan-1-amine;dodecan-2-amine |
| PubChem CID | 88815564 |
| Molecular Formula | C24H54N2 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 370.43 |
| IUPAC Name | dodecan-1-amine;dodecan-2-amine |
| SMILES | CCCCCCCCCCC(C)N.CCCCCCCCCCCCN |
| InChI | InChI=1S/2C12H27N/c1-3-4-5-6-7-8-9-10-11-12(2)13;1-2-3-4-5-6-7-8-9-10-11-12-13/h12H,3-11,13H2,1-2H3;2-13H2,1H3 |
| InChIKey | RDMTVNMWAHOBDP-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecan-1-amine;dodecan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-1-amine;dodecan-2-amine?
The IUPAC name of dodecan-1-amine;dodecan-2-amine (CID 88815564) is dodecan-1-amine;dodecan-2-amine.
What is the SMILES notation for dodecan-1-amine;dodecan-2-amine?
The canonical SMILES for dodecan-1-amine;dodecan-2-amine is CCCCCCCCCCC(C)N.CCCCCCCCCCCCN.
What is the InChIKey of dodecan-1-amine;dodecan-2-amine?
The InChIKey is RDMTVNMWAHOBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H27N/c1-3-4-5-6-7-8-9-10-11-12(2)13;1-2-3-4-5-6-7-8-9-10-11-12-13/h12H,3-11,13H2,1-2H3;2-13H2,1H3.
What are the key properties of dodecan-1-amine;dodecan-2-amine?
dodecan-1-amine;dodecan-2-amine has a molecular weight of 370.71 g/mol, XLogP of 7.73, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-1-amine;dodecan-2-amine is sourced from PubChem (CID 88815564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).