About dodecan-2-amine;hydrochloride
dodecan-2-amine;hydrochloride (PubChem CID 86195878) has the molecular formula C12H28ClN
and a molecular weight of 221.82 g/mol. Its IUPAC name is dodecan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | dodecan-2-amine;hydrochloride |
| PubChem CID | 86195878 |
| Molecular Formula | C12H28ClN |
| Molecular Weight | 221.82 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | dodecan-2-amine;hydrochloride |
| SMILES | CCCCCCCCCCC(C)N.Cl |
| InChI | InChI=1S/C12H27N.ClH/c1-3-4-5-6-7-8-9-10-11-12(2)13;/h12H,3-11,13H2,1-2H3;1H |
| InChIKey | DVGQDWICISAVKG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-2-amine;hydrochloride?
The IUPAC name of dodecan-2-amine;hydrochloride (CID 86195878) is dodecan-2-amine;hydrochloride.
What is the SMILES notation for dodecan-2-amine;hydrochloride?
The canonical SMILES for dodecan-2-amine;hydrochloride is CCCCCCCCCCC(C)N.Cl.
What is the InChIKey of dodecan-2-amine;hydrochloride?
The InChIKey is DVGQDWICISAVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.ClH/c1-3-4-5-6-7-8-9-10-11-12(2)13;/h12H,3-11,13H2,1-2H3;1H.
What are the key properties of dodecan-2-amine;hydrochloride?
dodecan-2-amine;hydrochloride has a molecular weight of 221.82 g/mol, XLogP of 4.29, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-2-amine;hydrochloride is sourced from PubChem (CID 86195878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).