About (2S)-nonadecan-2-amine
(2S)-nonadecan-2-amine (PubChem CID 94864909) has the molecular formula C19H41N
and a molecular weight of 283.54 g/mol. Its IUPAC name is (2S)-nonadecan-2-amine.
Molecular Properties
| Compound Name | (2S)-nonadecan-2-amine |
| PubChem CID | 94864909 |
| Molecular Formula | C19H41N |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.32 |
| IUPAC Name | (2S)-nonadecan-2-amine |
| SMILES | CCCCCCCCCCCCCCCCC[C@H](C)N |
| InChI | InChI=1S/C19H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20/h19H,3-18,20H2,1-2H3/t19-/m0/s1 |
| InChIKey | CRTBHHWJNLQHEB-IBGZPJMESA-N |
| XLogP | 6.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-nonadecan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-nonadecan-2-amine?
The IUPAC name of (2S)-nonadecan-2-amine (CID 94864909) is (2S)-nonadecan-2-amine.
What is the SMILES notation for (2S)-nonadecan-2-amine?
The canonical SMILES for (2S)-nonadecan-2-amine is CCCCCCCCCCCCCCCCC[C@H](C)N.
What is the InChIKey of (2S)-nonadecan-2-amine?
The InChIKey is CRTBHHWJNLQHEB-IBGZPJMESA-N. The full InChI is InChI=1S/C19H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)20/h19H,3-18,20H2,1-2H3/t19-/m0/s1.
What are the key properties of (2S)-nonadecan-2-amine?
(2S)-nonadecan-2-amine has a molecular weight of 283.54 g/mol, XLogP of 6.60, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-nonadecan-2-amine is sourced from PubChem (CID 94864909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).