About propanoic acid;tetradecan-2-amine
propanoic acid;tetradecan-2-amine (PubChem CID 173174901) has the molecular formula C17H37NO2
and a molecular weight of 287.49 g/mol. Its IUPAC name is propanoic acid;tetradecan-2-amine.
Molecular Properties
| Compound Name | propanoic acid;tetradecan-2-amine |
| PubChem CID | 173174901 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | propanoic acid;tetradecan-2-amine |
| SMILES | CCC(=O)O.CCCCCCCCCCCCC(C)N |
| InChI | InChI=1S/C14H31N.C3H6O2/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15;1-2-3(4)5/h14H,3-13,15H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | PAKYIBWWVNKBMC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propanoic acid;tetradecan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;tetradecan-2-amine?
The IUPAC name of propanoic acid;tetradecan-2-amine (CID 173174901) is propanoic acid;tetradecan-2-amine.
What is the SMILES notation for propanoic acid;tetradecan-2-amine?
The canonical SMILES for propanoic acid;tetradecan-2-amine is CCC(=O)O.CCCCCCCCCCCCC(C)N.
What is the InChIKey of propanoic acid;tetradecan-2-amine?
The InChIKey is PAKYIBWWVNKBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.C3H6O2/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15;1-2-3(4)5/h14H,3-13,15H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of propanoic acid;tetradecan-2-amine?
propanoic acid;tetradecan-2-amine has a molecular weight of 287.49 g/mol, XLogP of 5.13, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;tetradecan-2-amine is sourced from PubChem (CID 173174901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).