About bis(hexan-2-amine);oxalic acid
bis(hexan-2-amine);oxalic acid (PubChem CID 175216358) has the molecular formula C14H32N2O4
and a molecular weight of 292.42 g/mol. Its IUPAC name is bis(hexan-2-amine);oxalic acid.
Molecular Properties
| Compound Name | bis(hexan-2-amine);oxalic acid |
| PubChem CID | 175216358 |
| Molecular Formula | C14H32N2O4 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | bis(hexan-2-amine);oxalic acid |
| SMILES | CCCCC(C)N.CCCCC(C)N.O=C(O)C(=O)O |
| InChI | InChI=1S/2C6H15N.C2H2O4/c2*1-3-4-5-6(2)7;3-1(4)2(5)6/h2*6H,3-5,7H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MEYXOVZZLQEMTC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(hexan-2-amine);oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hexan-2-amine);oxalic acid?
The IUPAC name of bis(hexan-2-amine);oxalic acid (CID 175216358) is bis(hexan-2-amine);oxalic acid.
What is the SMILES notation for bis(hexan-2-amine);oxalic acid?
The canonical SMILES for bis(hexan-2-amine);oxalic acid is CCCCC(C)N.CCCCC(C)N.O=C(O)C(=O)O.
What is the InChIKey of bis(hexan-2-amine);oxalic acid?
The InChIKey is MEYXOVZZLQEMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15N.C2H2O4/c2*1-3-4-5-6(2)7;3-1(4)2(5)6/h2*6H,3-5,7H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of bis(hexan-2-amine);oxalic acid?
bis(hexan-2-amine);oxalic acid has a molecular weight of 292.42 g/mol, XLogP of 2.20, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hexan-2-amine);oxalic acid is sourced from PubChem (CID 175216358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).