About 6-amino-2-oxoheptanoic acid
6-amino-2-oxoheptanoic acid (PubChem CID 87327623) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 6-amino-2-oxoheptanoic acid.
Molecular Properties
| Compound Name | 6-amino-2-oxoheptanoic acid |
| PubChem CID | 87327623 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 6-amino-2-oxoheptanoic acid |
| SMILES | CC(N)CCCC(=O)C(=O)O |
| InChI | InChI=1S/C7H13NO3/c1-5(8)3-2-4-6(9)7(10)11/h5H,2-4,8H2,1H3,(H,10,11) |
| InChIKey | GFZSQWJAQNJAGT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-oxoheptanoic acid?
The IUPAC name of 6-amino-2-oxoheptanoic acid (CID 87327623) is 6-amino-2-oxoheptanoic acid.
What is the SMILES notation for 6-amino-2-oxoheptanoic acid?
The canonical SMILES for 6-amino-2-oxoheptanoic acid is CC(N)CCCC(=O)C(=O)O.
What is the InChIKey of 6-amino-2-oxoheptanoic acid?
The InChIKey is GFZSQWJAQNJAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-5(8)3-2-4-6(9)7(10)11/h5H,2-4,8H2,1H3,(H,10,11).
What are the key properties of 6-amino-2-oxoheptanoic acid?
6-amino-2-oxoheptanoic acid has a molecular weight of 159.19 g/mol, XLogP of 0.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-oxoheptanoic acid is sourced from PubChem (CID 87327623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).