About (5S)-5-aminohexanamide;hydrochloride
(5S)-5-aminohexanamide;hydrochloride (PubChem CID 174367343) has the molecular formula C6H15ClN2O
and a molecular weight of 166.65 g/mol. Its IUPAC name is (5S)-5-aminohexanamide;hydrochloride.
Molecular Properties
| Compound Name | (5S)-5-aminohexanamide;hydrochloride |
| PubChem CID | 174367343 |
| Molecular Formula | C6H15ClN2O |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (5S)-5-aminohexanamide;hydrochloride |
| SMILES | C[C@H](N)CCCC(N)=O.Cl |
| InChI | InChI=1S/C6H14N2O.ClH/c1-5(7)3-2-4-6(8)9;/h5H,2-4,7H2,1H3,(H2,8,9);1H/t5-;/m0./s1 |
| InChIKey | ALZNKGLWXOHMSA-JEDNCBNOSA-N |
| XLogP | 0.41 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-aminohexanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-aminohexanamide;hydrochloride?
The IUPAC name of (5S)-5-aminohexanamide;hydrochloride (CID 174367343) is (5S)-5-aminohexanamide;hydrochloride.
What is the SMILES notation for (5S)-5-aminohexanamide;hydrochloride?
The canonical SMILES for (5S)-5-aminohexanamide;hydrochloride is C[C@H](N)CCCC(N)=O.Cl.
What is the InChIKey of (5S)-5-aminohexanamide;hydrochloride?
The InChIKey is ALZNKGLWXOHMSA-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H14N2O.ClH/c1-5(7)3-2-4-6(8)9;/h5H,2-4,7H2,1H3,(H2,8,9);1H/t5-;/m0./s1.
What are the key properties of (5S)-5-aminohexanamide;hydrochloride?
(5S)-5-aminohexanamide;hydrochloride has a molecular weight of 166.65 g/mol, XLogP of 0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-aminohexanamide;hydrochloride is sourced from PubChem (CID 174367343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).