About hexan-2-amine;pyridine-4-carboxylic acid
hexan-2-amine;pyridine-4-carboxylic acid (PubChem CID 159105721) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is hexan-2-amine;pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | hexan-2-amine;pyridine-4-carboxylic acid |
| PubChem CID | 159105721 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | hexan-2-amine;pyridine-4-carboxylic acid |
| SMILES | CCCCC(C)N.O=C(O)c1ccncc1 |
| InChI | InChI=1S/C6H5NO2.C6H15N/c8-6(9)5-1-3-7-4-2-5;1-3-4-5-6(2)7/h1-4H,(H,8,9);6H,3-5,7H2,1-2H3 |
| InChIKey | KDVXNYCMRFCGKM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hexan-2-amine;pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-amine;pyridine-4-carboxylic acid?
The IUPAC name of hexan-2-amine;pyridine-4-carboxylic acid (CID 159105721) is hexan-2-amine;pyridine-4-carboxylic acid.
What is the SMILES notation for hexan-2-amine;pyridine-4-carboxylic acid?
The canonical SMILES for hexan-2-amine;pyridine-4-carboxylic acid is CCCCC(C)N.O=C(O)c1ccncc1.
What is the InChIKey of hexan-2-amine;pyridine-4-carboxylic acid?
The InChIKey is KDVXNYCMRFCGKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C6H15N/c8-6(9)5-1-3-7-4-2-5;1-3-4-5-6(2)7/h1-4H,(H,8,9);6H,3-5,7H2,1-2H3.
What are the key properties of hexan-2-amine;pyridine-4-carboxylic acid?
hexan-2-amine;pyridine-4-carboxylic acid has a molecular weight of 224.30 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-amine;pyridine-4-carboxylic acid is sourced from PubChem (CID 159105721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).