hydrazinecarboxylic acid;pyridine-4-carboxylic acid

C7H9N3O4 — CID 161178249

IUPAChydrazinecarboxylic acid;pyridine-4-carboxylic acid
SMILESNNC(=O)O.O=C(O)c1ccncc1
InChIInChI=1S/C6H5NO2.CH4N2O2/c8-6(9)5-1-3-7-4-2-5;2-3-1(4)5/h1-4H,(H,8,9);3H,2H2,(H,4,5)
InChIKeyUSCHEALRWYKYRM-UHFFFAOYSA-N
MW199.17 g/mol
LogP-0.09
Rot. Bonds1

About hydrazinecarboxylic acid;pyridine-4-carboxylic acid

hydrazinecarboxylic acid;pyridine-4-carboxylic acid (PubChem CID 161178249) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is hydrazinecarboxylic acid;pyridine-4-carboxylic acid.

Molecular Properties

Compound Namehydrazinecarboxylic acid;pyridine-4-carboxylic acid
PubChem CID161178249
Molecular FormulaC7H9N3O4
Molecular Weight199.17 g/mol
Exact Mass199.06
IUPAC Namehydrazinecarboxylic acid;pyridine-4-carboxylic acid
SMILESNNC(=O)O.O=C(O)c1ccncc1
InChIInChI=1S/C6H5NO2.CH4N2O2/c8-6(9)5-1-3-7-4-2-5;2-3-1(4)5/h1-4H,(H,8,9);3H,2H2,(H,4,5)
InChIKeyUSCHEALRWYKYRM-UHFFFAOYSA-N
XLogP-0.09
TPSA125.54 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.17
LogP ≤ 5-0.09
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze hydrazinecarboxylic acid;pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
The IUPAC name of hydrazinecarboxylic acid;pyridine-4-carboxylic acid (CID 161178249) is hydrazinecarboxylic acid;pyridine-4-carboxylic acid.
What is the SMILES notation for hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
The canonical SMILES for hydrazinecarboxylic acid;pyridine-4-carboxylic acid is NNC(=O)O.O=C(O)c1ccncc1.
What is the InChIKey of hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
The InChIKey is USCHEALRWYKYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.CH4N2O2/c8-6(9)5-1-3-7-4-2-5;2-3-1(4)5/h1-4H,(H,8,9);3H,2H2,(H,4,5).
What are the key properties of hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
hydrazinecarboxylic acid;pyridine-4-carboxylic acid has a molecular weight of 199.17 g/mol, XLogP of -0.09, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinecarboxylic acid;pyridine-4-carboxylic acid is sourced from PubChem (CID 161178249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).