About hydrazinecarboxylic acid;pyridine-4-carboxylic acid
hydrazinecarboxylic acid;pyridine-4-carboxylic acid (PubChem CID 161178249) has the molecular formula C7H9N3O4
and a molecular weight of 199.17 g/mol. Its IUPAC name is hydrazinecarboxylic acid;pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | hydrazinecarboxylic acid;pyridine-4-carboxylic acid |
| PubChem CID | 161178249 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | hydrazinecarboxylic acid;pyridine-4-carboxylic acid |
| SMILES | NNC(=O)O.O=C(O)c1ccncc1 |
| InChI | InChI=1S/C6H5NO2.CH4N2O2/c8-6(9)5-1-3-7-4-2-5;2-3-1(4)5/h1-4H,(H,8,9);3H,2H2,(H,4,5) |
| InChIKey | USCHEALRWYKYRM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazinecarboxylic acid;pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
The IUPAC name of hydrazinecarboxylic acid;pyridine-4-carboxylic acid (CID 161178249) is hydrazinecarboxylic acid;pyridine-4-carboxylic acid.
What is the SMILES notation for hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
The canonical SMILES for hydrazinecarboxylic acid;pyridine-4-carboxylic acid is NNC(=O)O.O=C(O)c1ccncc1.
What is the InChIKey of hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
The InChIKey is USCHEALRWYKYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.CH4N2O2/c8-6(9)5-1-3-7-4-2-5;2-3-1(4)5/h1-4H,(H,8,9);3H,2H2,(H,4,5).
What are the key properties of hydrazinecarboxylic acid;pyridine-4-carboxylic acid?
hydrazinecarboxylic acid;pyridine-4-carboxylic acid has a molecular weight of 199.17 g/mol, XLogP of -0.09, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinecarboxylic acid;pyridine-4-carboxylic acid is sourced from PubChem (CID 161178249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).