About CID 69045386
CID 69045386 (PubChem CID 69045386) has the molecular formula C6H7N3NaO
and a molecular weight of 160.13 g/mol.
Molecular Properties
| Compound Name | CID 69045386 |
| PubChem CID | 69045386 |
| Molecular Formula | C6H7N3NaO |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | — |
| SMILES | NNC(=O)c1ccncc1.[Na] |
| InChI | InChI=1S/C6H7N3O.Na/c7-9-6(10)5-1-3-8-4-2-5;/h1-4H,7H2,(H,9,10); |
| InChIKey | XSMXPRSGVLBCDL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 69045386 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69045386?
The IUPAC name of CID 69045386 (CID 69045386) is not available.
What is the SMILES notation for CID 69045386?
The canonical SMILES for CID 69045386 is NNC(=O)c1ccncc1.[Na].
What is the InChIKey of CID 69045386?
The InChIKey is XSMXPRSGVLBCDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O.Na/c7-9-6(10)5-1-3-8-4-2-5;/h1-4H,7H2,(H,9,10);.
What are the key properties of CID 69045386?
CID 69045386 has a molecular weight of 160.13 g/mol, XLogP of -0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69045386 is sourced from PubChem (CID 69045386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).