About sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide
sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide (PubChem CID 54605407) has the molecular formula C13H15N3NaO4+
and a molecular weight of 300.27 g/mol. Its IUPAC name is sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide.
Molecular Properties
| Compound Name | sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide |
| PubChem CID | 54605407 |
| Molecular Formula | C13H15N3NaO4+ |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide |
| SMILES | C=C1C(=O)CCC1C(=O)O.NNC(=O)c1ccncc1.[Na+] |
| InChI | InChI=1S/C7H8O3.C6H7N3O.Na/c1-4-5(7(9)10)2-3-6(4)8;7-9-6(10)5-1-3-8-4-2-5;/h5H,1-3H2,(H,9,10);1-4H,7H2,(H,9,10);/q;;+1 |
| InChIKey | ZUQRWWCNRXYYKC-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide?
The IUPAC name of sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide (CID 54605407) is sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide.
What is the SMILES notation for sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide?
The canonical SMILES for sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide is C=C1C(=O)CCC1C(=O)O.NNC(=O)c1ccncc1.[Na+].
What is the InChIKey of sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide?
The InChIKey is ZUQRWWCNRXYYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3.C6H7N3O.Na/c1-4-5(7(9)10)2-3-6(4)8;7-9-6(10)5-1-3-8-4-2-5;/h5H,1-3H2,(H,9,10);1-4H,7H2,(H,9,10);/q;;+1.
What are the key properties of sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide?
sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide has a molecular weight of 300.27 g/mol, XLogP of -2.70, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methylidene-3-oxocyclopentane-1-carboxylic acid;pyridine-4-carbohydrazide is sourced from PubChem (CID 54605407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).