About pyridine-4-carbohydrazide;trihydrate;hydrochloride
pyridine-4-carbohydrazide;trihydrate;hydrochloride (PubChem CID 67630424) has the molecular formula C6H14ClN3O4
and a molecular weight of 227.65 g/mol. Its IUPAC name is pyridine-4-carbohydrazide;trihydrate;hydrochloride.
Molecular Properties
| Compound Name | pyridine-4-carbohydrazide;trihydrate;hydrochloride |
| PubChem CID | 67630424 |
| Molecular Formula | C6H14ClN3O4 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | pyridine-4-carbohydrazide;trihydrate;hydrochloride |
| SMILES | Cl.NNC(=O)c1ccncc1.O.O.O |
| InChI | InChI=1S/C6H7N3O.ClH.3H2O/c7-9-6(10)5-1-3-8-4-2-5;;;;/h1-4H,7H2,(H,9,10);1H;3*1H2 |
| InChIKey | KZVVFOJOTMRTLJ-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyridine-4-carbohydrazide;trihydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-4-carbohydrazide;trihydrate;hydrochloride?
The IUPAC name of pyridine-4-carbohydrazide;trihydrate;hydrochloride (CID 67630424) is pyridine-4-carbohydrazide;trihydrate;hydrochloride.
What is the SMILES notation for pyridine-4-carbohydrazide;trihydrate;hydrochloride?
The canonical SMILES for pyridine-4-carbohydrazide;trihydrate;hydrochloride is Cl.NNC(=O)c1ccncc1.O.O.O.
What is the InChIKey of pyridine-4-carbohydrazide;trihydrate;hydrochloride?
The InChIKey is KZVVFOJOTMRTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O.ClH.3H2O/c7-9-6(10)5-1-3-8-4-2-5;;;;/h1-4H,7H2,(H,9,10);1H;3*1H2.
What are the key properties of pyridine-4-carbohydrazide;trihydrate;hydrochloride?
pyridine-4-carbohydrazide;trihydrate;hydrochloride has a molecular weight of 227.65 g/mol, XLogP of -2.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-4-carbohydrazide;trihydrate;hydrochloride is sourced from PubChem (CID 67630424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).