About hydrazine;pyridine-4-carboxamide;hydrate
hydrazine;pyridine-4-carboxamide;hydrate (PubChem CID 170336563) has the molecular formula C6H12N4O2
and a molecular weight of 172.19 g/mol. Its IUPAC name is hydrazine;pyridine-4-carboxamide;hydrate.
Molecular Properties
| Compound Name | hydrazine;pyridine-4-carboxamide;hydrate |
| PubChem CID | 170336563 |
| Molecular Formula | C6H12N4O2 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | hydrazine;pyridine-4-carboxamide;hydrate |
| SMILES | NC(=O)c1ccncc1.NN.O |
| InChI | InChI=1S/C6H6N2O.H4N2.H2O/c7-6(9)5-1-3-8-4-2-5;1-2;/h1-4H,(H2,7,9);1-2H2;1H2 |
| InChIKey | BBQGBZRSXWJMCC-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;pyridine-4-carboxamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;pyridine-4-carboxamide;hydrate?
The IUPAC name of hydrazine;pyridine-4-carboxamide;hydrate (CID 170336563) is hydrazine;pyridine-4-carboxamide;hydrate.
What is the SMILES notation for hydrazine;pyridine-4-carboxamide;hydrate?
The canonical SMILES for hydrazine;pyridine-4-carboxamide;hydrate is NC(=O)c1ccncc1.NN.O.
What is the InChIKey of hydrazine;pyridine-4-carboxamide;hydrate?
The InChIKey is BBQGBZRSXWJMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.H4N2.H2O/c7-6(9)5-1-3-8-4-2-5;1-2;/h1-4H,(H2,7,9);1-2H2;1H2.
What are the key properties of hydrazine;pyridine-4-carboxamide;hydrate?
hydrazine;pyridine-4-carboxamide;hydrate has a molecular weight of 172.19 g/mol, XLogP of -1.83, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;pyridine-4-carboxamide;hydrate is sourced from PubChem (CID 170336563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).