About benzamide;pyridine-4-carboxamide
benzamide;pyridine-4-carboxamide (PubChem CID 175267661) has the molecular formula C13H13N3O2
and a molecular weight of 243.27 g/mol. Its IUPAC name is benzamide;pyridine-4-carboxamide.
Molecular Properties
| Compound Name | benzamide;pyridine-4-carboxamide |
| PubChem CID | 175267661 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | benzamide;pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccccc1.NC(=O)c1ccncc1 |
| InChI | InChI=1S/C7H7NO.C6H6N2O/c8-7(9)6-4-2-1-3-5-6;7-6(9)5-1-3-8-4-2-5/h1-5H,(H2,8,9);1-4H,(H2,7,9) |
| InChIKey | DKCMINZHUUZJJG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzamide;pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;pyridine-4-carboxamide?
The IUPAC name of benzamide;pyridine-4-carboxamide (CID 175267661) is benzamide;pyridine-4-carboxamide.
What is the SMILES notation for benzamide;pyridine-4-carboxamide?
The canonical SMILES for benzamide;pyridine-4-carboxamide is NC(=O)c1ccccc1.NC(=O)c1ccncc1.
What is the InChIKey of benzamide;pyridine-4-carboxamide?
The InChIKey is DKCMINZHUUZJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C6H6N2O/c8-7(9)6-4-2-1-3-5-6;7-6(9)5-1-3-8-4-2-5/h1-5H,(H2,8,9);1-4H,(H2,7,9).
What are the key properties of benzamide;pyridine-4-carboxamide?
benzamide;pyridine-4-carboxamide has a molecular weight of 243.27 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;pyridine-4-carboxamide is sourced from PubChem (CID 175267661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).