About benzamide;hydron
benzamide;hydron (PubChem CID 68819060) has the molecular formula C7H8NO+
and a molecular weight of 122.15 g/mol. Its IUPAC name is benzamide;hydron.
Molecular Properties
| Compound Name | benzamide;hydron |
| PubChem CID | 68819060 |
| Molecular Formula | C7H8NO+ |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | benzamide;hydron |
| SMILES | NC(=O)c1ccccc1.[H+] |
| InChI | InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9)/p+1 |
| InChIKey | KXDAEFPNCMNJSK-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzamide;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;hydron?
The IUPAC name of benzamide;hydron (CID 68819060) is benzamide;hydron.
What is the SMILES notation for benzamide;hydron?
The canonical SMILES for benzamide;hydron is NC(=O)c1ccccc1.[H+].
What is the InChIKey of benzamide;hydron?
The InChIKey is KXDAEFPNCMNJSK-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9)/p+1.
What are the key properties of benzamide;hydron?
benzamide;hydron has a molecular weight of 122.15 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;hydron is sourced from PubChem (CID 68819060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).