About benzamide;2,3-dimethylbutane
benzamide;2,3-dimethylbutane (PubChem CID 162214835) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is benzamide;2,3-dimethylbutane.
Molecular Properties
| Compound Name | benzamide;2,3-dimethylbutane |
| PubChem CID | 162214835 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | benzamide;2,3-dimethylbutane |
| SMILES | CC(C)C(C)C.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.C6H14/c8-7(9)6-4-2-1-3-5-6;1-5(2)6(3)4/h1-5H,(H2,8,9);5-6H,1-4H3 |
| InChIKey | ZTIAPPIPMVPANG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzamide;2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;2,3-dimethylbutane?
The IUPAC name of benzamide;2,3-dimethylbutane (CID 162214835) is benzamide;2,3-dimethylbutane.
What is the SMILES notation for benzamide;2,3-dimethylbutane?
The canonical SMILES for benzamide;2,3-dimethylbutane is CC(C)C(C)C.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;2,3-dimethylbutane?
The InChIKey is ZTIAPPIPMVPANG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C6H14/c8-7(9)6-4-2-1-3-5-6;1-5(2)6(3)4/h1-5H,(H2,8,9);5-6H,1-4H3.
What are the key properties of benzamide;2,3-dimethylbutane?
benzamide;2,3-dimethylbutane has a molecular weight of 207.32 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;2,3-dimethylbutane is sourced from PubChem (CID 162214835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).