About benzamide;trifluoroborane
benzamide;trifluoroborane (PubChem CID 158302663) has the molecular formula C7H7BF3NO
and a molecular weight of 188.95 g/mol. Its IUPAC name is benzamide;trifluoroborane.
Molecular Properties
| Compound Name | benzamide;trifluoroborane |
| PubChem CID | 158302663 |
| Molecular Formula | C7H7BF3NO |
| Molecular Weight | 188.95 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | benzamide;trifluoroborane |
| SMILES | FB(F)F.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.BF3/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H2,8,9); |
| InChIKey | GMRJZYKOEMZZBA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.95 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzamide;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;trifluoroborane?
The IUPAC name of benzamide;trifluoroborane (CID 158302663) is benzamide;trifluoroborane.
What is the SMILES notation for benzamide;trifluoroborane?
The canonical SMILES for benzamide;trifluoroborane is FB(F)F.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;trifluoroborane?
The InChIKey is GMRJZYKOEMZZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.BF3/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H2,8,9);.
What are the key properties of benzamide;trifluoroborane?
benzamide;trifluoroborane has a molecular weight of 188.95 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;trifluoroborane is sourced from PubChem (CID 158302663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).