About benzamide;pyrazine
benzamide;pyrazine (PubChem CID 67119172) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is benzamide;pyrazine.
Molecular Properties
| Compound Name | benzamide;pyrazine |
| PubChem CID | 67119172 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | benzamide;pyrazine |
| SMILES | NC(=O)c1ccccc1.c1cnccn1 |
| InChI | InChI=1S/C7H7NO.C4H4N2/c8-7(9)6-4-2-1-3-5-6;1-2-6-4-3-5-1/h1-5H,(H2,8,9);1-4H |
| InChIKey | ZPVWTMYGZMWHCW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzamide;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;pyrazine?
The IUPAC name of benzamide;pyrazine (CID 67119172) is benzamide;pyrazine.
What is the SMILES notation for benzamide;pyrazine?
The canonical SMILES for benzamide;pyrazine is NC(=O)c1ccccc1.c1cnccn1.
What is the InChIKey of benzamide;pyrazine?
The InChIKey is ZPVWTMYGZMWHCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C4H4N2/c8-7(9)6-4-2-1-3-5-6;1-2-6-4-3-5-1/h1-5H,(H2,8,9);1-4H.
What are the key properties of benzamide;pyrazine?
benzamide;pyrazine has a molecular weight of 201.23 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;pyrazine is sourced from PubChem (CID 67119172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).