About pyridine;pyridine-4-carboxamide
pyridine;pyridine-4-carboxamide (PubChem CID 70513287) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is pyridine;pyridine-4-carboxamide.
Molecular Properties
| Compound Name | pyridine;pyridine-4-carboxamide |
| PubChem CID | 70513287 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | pyridine;pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/C6H6N2O.C5H5N/c7-6(9)5-1-3-8-4-2-5;1-2-4-6-5-3-1/h1-4H,(H2,7,9);1-5H |
| InChIKey | AMELRMHLOXHKIP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine;pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;pyridine-4-carboxamide?
The IUPAC name of pyridine;pyridine-4-carboxamide (CID 70513287) is pyridine;pyridine-4-carboxamide.
What is the SMILES notation for pyridine;pyridine-4-carboxamide?
The canonical SMILES for pyridine;pyridine-4-carboxamide is NC(=O)c1ccncc1.c1ccncc1.
What is the InChIKey of pyridine;pyridine-4-carboxamide?
The InChIKey is AMELRMHLOXHKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C5H5N/c7-6(9)5-1-3-8-4-2-5;1-2-4-6-5-3-1/h1-4H,(H2,7,9);1-5H.
What are the key properties of pyridine;pyridine-4-carboxamide?
pyridine;pyridine-4-carboxamide has a molecular weight of 201.23 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;pyridine-4-carboxamide is sourced from PubChem (CID 70513287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).