C13H9F3N2O3 — CID 139184205
pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid (PubChem CID 139184205) has the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. Its IUPAC name is pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid.
| Compound Name | pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid |
|---|---|
| PubChem CID | 139184205 |
| Molecular Formula | C13H9F3N2O3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid |
| SMILES | NC(=O)c1ccncc1.O=C(O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C7H3F3O2.C6H6N2O/c8-4-2-6(10)5(9)1-3(4)7(11)12;7-6(9)5-1-3-8-4-2-5/h1-2H,(H,11,12);1-4H,(H2,7,9) |
| InChIKey | AZTRHSISYKJGCS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|