pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid

C13H9F3N2O3 — CID 139184205

IUPACpyridine-4-carboxamide;2,4,5-trifluorobenzoic acid
SMILESNC(=O)c1ccncc1.O=C(O)c1cc(F)c(F)cc1F
InChIInChI=1S/C7H3F3O2.C6H6N2O/c8-4-2-6(10)5(9)1-3(4)7(11)12;7-6(9)5-1-3-8-4-2-5/h1-2H,(H,11,12);1-4H,(H2,7,9)
InChIKeyAZTRHSISYKJGCS-UHFFFAOYSA-N
MW298.22 g/mol
LogP1.98
Rot. Bonds2

About pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid

pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid (PubChem CID 139184205) has the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. Its IUPAC name is pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid.

Molecular Properties

Compound Namepyridine-4-carboxamide;2,4,5-trifluorobenzoic acid
PubChem CID139184205
Molecular FormulaC13H9F3N2O3
Molecular Weight298.22 g/mol
Exact Mass298.06
IUPAC Namepyridine-4-carboxamide;2,4,5-trifluorobenzoic acid
SMILESNC(=O)c1ccncc1.O=C(O)c1cc(F)c(F)cc1F
InChIInChI=1S/C7H3F3O2.C6H6N2O/c8-4-2-6(10)5(9)1-3(4)7(11)12;7-6(9)5-1-3-8-4-2-5/h1-2H,(H,11,12);1-4H,(H2,7,9)
InChIKeyAZTRHSISYKJGCS-UHFFFAOYSA-N
XLogP1.98
TPSA93.28 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.22
LogP ≤ 51.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid?
The IUPAC name of pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid (CID 139184205) is pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid.
What is the SMILES notation for pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid?
The canonical SMILES for pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid is NC(=O)c1ccncc1.O=C(O)c1cc(F)c(F)cc1F.
What is the InChIKey of pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid?
The InChIKey is AZTRHSISYKJGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F3O2.C6H6N2O/c8-4-2-6(10)5(9)1-3(4)7(11)12;7-6(9)5-1-3-8-4-2-5/h1-2H,(H,11,12);1-4H,(H2,7,9).
What are the key properties of pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid?
pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid has a molecular weight of 298.22 g/mol, XLogP of 1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-4-carboxamide;2,4,5-trifluorobenzoic acid is sourced from PubChem (CID 139184205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).