About nonanedioic acid;bis(pyridine-4-carboxamide)
nonanedioic acid;bis(pyridine-4-carboxamide) (PubChem CID 139205511) has the molecular formula C21H28N4O6
and a molecular weight of 432.48 g/mol. Its IUPAC name is nonanedioic acid;bis(pyridine-4-carboxamide).
Molecular Properties
| Compound Name | nonanedioic acid;bis(pyridine-4-carboxamide) |
| PubChem CID | 139205511 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | nonanedioic acid;bis(pyridine-4-carboxamide) |
| SMILES | NC(=O)c1ccncc1.NC(=O)c1ccncc1.O=C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C9H16O4.2C6H6N2O/c10-8(11)6-4-2-1-3-5-7-9(12)13;2*7-6(9)5-1-3-8-4-2-5/h1-7H2,(H,10,11)(H,12,13);2*1-4H,(H2,7,9) |
| InChIKey | VNLZACDYJLWCDO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 186.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonanedioic acid;bis(pyridine-4-carboxamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonanedioic acid;bis(pyridine-4-carboxamide)?
The IUPAC name of nonanedioic acid;bis(pyridine-4-carboxamide) (CID 139205511) is nonanedioic acid;bis(pyridine-4-carboxamide).
What is the SMILES notation for nonanedioic acid;bis(pyridine-4-carboxamide)?
The canonical SMILES for nonanedioic acid;bis(pyridine-4-carboxamide) is NC(=O)c1ccncc1.NC(=O)c1ccncc1.O=C(O)CCCCCCCC(=O)O.
What is the InChIKey of nonanedioic acid;bis(pyridine-4-carboxamide)?
The InChIKey is VNLZACDYJLWCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.2C6H6N2O/c10-8(11)6-4-2-1-3-5-7-9(12)13;2*7-6(9)5-1-3-8-4-2-5/h1-7H2,(H,10,11)(H,12,13);2*1-4H,(H2,7,9).
What are the key properties of nonanedioic acid;bis(pyridine-4-carboxamide)?
nonanedioic acid;bis(pyridine-4-carboxamide) has a molecular weight of 432.48 g/mol, XLogP of 2.25, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nonanedioic acid;bis(pyridine-4-carboxamide) is sourced from PubChem (CID 139205511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).