About benzamide;hexanoic acid
benzamide;hexanoic acid (PubChem CID 19438402) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is benzamide;hexanoic acid.
Molecular Properties
| Compound Name | benzamide;hexanoic acid |
| PubChem CID | 19438402 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | benzamide;hexanoic acid |
| SMILES | CCCCCC(=O)O.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H7NO.C6H12O2/c8-7(9)6-4-2-1-3-5-6;1-2-3-4-5-6(7)8/h1-5H,(H2,8,9);2-5H2,1H3,(H,7,8) |
| InChIKey | JHQYAZHLRDVREZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzamide;hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;hexanoic acid?
The IUPAC name of benzamide;hexanoic acid (CID 19438402) is benzamide;hexanoic acid.
What is the SMILES notation for benzamide;hexanoic acid?
The canonical SMILES for benzamide;hexanoic acid is CCCCCC(=O)O.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;hexanoic acid?
The InChIKey is JHQYAZHLRDVREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C6H12O2/c8-7(9)6-4-2-1-3-5-6;1-2-3-4-5-6(7)8/h1-5H,(H2,8,9);2-5H2,1H3,(H,7,8).
What are the key properties of benzamide;hexanoic acid?
benzamide;hexanoic acid has a molecular weight of 237.30 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;hexanoic acid is sourced from PubChem (CID 19438402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).