C19H31N3O3 — CID 175165478
benzene-1,4-dicarboxamide;undecanamide (PubChem CID 175165478) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;undecanamide.
| Compound Name | benzene-1,4-dicarboxamide;undecanamide |
|---|---|
| PubChem CID | 175165478 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | benzene-1,4-dicarboxamide;undecanamide |
| SMILES | CCCCCCCCCCC(N)=O.NC(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H23NO.C8H8N2O2/c1-2-3-4-5-6-7-8-9-10-11(12)13;9-7(11)5-1-2-6(4-3-5)8(10)12/h2-10H2,1H3,(H2,12,13);1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | LAGQHNAGELXUCB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|