C33H57N3O9 — CID 67992226
benzene-1,3,5-tricarboxylic acid;tris(octanamide) (PubChem CID 67992226) has the molecular formula C33H57N3O9 and a molecular weight of 639.83 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;tris(octanamide).
| Compound Name | benzene-1,3,5-tricarboxylic acid;tris(octanamide) |
|---|---|
| PubChem CID | 67992226 |
| Molecular Formula | C33H57N3O9 |
| Molecular Weight | 639.83 g/mol |
| Exact Mass | 639.41 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;tris(octanamide) |
| SMILES | CCCCCCCC(N)=O.CCCCCCCC(N)=O.CCCCCCCC(N)=O.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6.3C8H17NO/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;3*1-2-3-4-5-6-7-8(9)10/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*2-7H2,1H3,(H2,9,10) |
| InChIKey | LMKFRJSAVSECQP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 241.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.83 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|