C30H51N3O9 — CID 67992233
benzene-1,3,5-tricarboxylic acid;tris(heptanamide) (PubChem CID 67992233) has the molecular formula C30H51N3O9 and a molecular weight of 597.75 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;tris(heptanamide).
| Compound Name | benzene-1,3,5-tricarboxylic acid;tris(heptanamide) |
|---|---|
| PubChem CID | 67992233 |
| Molecular Formula | C30H51N3O9 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;tris(heptanamide) |
| SMILES | CCCCCCC(N)=O.CCCCCCC(N)=O.CCCCCCC(N)=O.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6.3C7H15NO/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;3*1-2-3-4-5-6-7(8)9/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*2-6H2,1H3,(H2,8,9) |
| InChIKey | ZJWMHQWTERWWCI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 241.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|