C27H45N3O9 — CID 67992130
benzene-1,3,5-tricarboxylic acid;tris(hexanamide) (PubChem CID 67992130) has the molecular formula C27H45N3O9 and a molecular weight of 555.67 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;tris(hexanamide).
| Compound Name | benzene-1,3,5-tricarboxylic acid;tris(hexanamide) |
|---|---|
| PubChem CID | 67992130 |
| Molecular Formula | C27H45N3O9 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;tris(hexanamide) |
| SMILES | CCCCCC(N)=O.CCCCCC(N)=O.CCCCCC(N)=O.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6.3C6H13NO/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;3*1-2-3-4-5-6(7)8/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*2-5H2,1H3,(H2,7,8) |
| InChIKey | PXISQCUZJPEFKL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 241.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|