About 4-octylbenzamide;hydrochloride
4-octylbenzamide;hydrochloride (PubChem CID 131740255) has the molecular formula C15H24ClNO
and a molecular weight of 269.82 g/mol. Its IUPAC name is 4-octylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-octylbenzamide;hydrochloride |
| PubChem CID | 131740255 |
| Molecular Formula | C15H24ClNO |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-octylbenzamide;hydrochloride |
| SMILES | CCCCCCCCc1ccc(C(N)=O)cc1.Cl |
| InChI | InChI=1S/C15H23NO.ClH/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)15(16)17;/h9-12H,2-8H2,1H3,(H2,16,17);1H |
| InChIKey | SIKPUGQJCOJJPH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octylbenzamide;hydrochloride?
The IUPAC name of 4-octylbenzamide;hydrochloride (CID 131740255) is 4-octylbenzamide;hydrochloride.
What is the SMILES notation for 4-octylbenzamide;hydrochloride?
The canonical SMILES for 4-octylbenzamide;hydrochloride is CCCCCCCCc1ccc(C(N)=O)cc1.Cl.
What is the InChIKey of 4-octylbenzamide;hydrochloride?
The InChIKey is SIKPUGQJCOJJPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO.ClH/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)15(16)17;/h9-12H,2-8H2,1H3,(H2,16,17);1H.
What are the key properties of 4-octylbenzamide;hydrochloride?
4-octylbenzamide;hydrochloride has a molecular weight of 269.82 g/mol, XLogP of 4.11, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octylbenzamide;hydrochloride is sourced from PubChem (CID 131740255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).