C17H26O — CID 59409785
1-(4-hexylphenyl)-2,2-dimethylpropan-1-one (PubChem CID 59409785) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-(4-hexylphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(4-hexylphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 59409785 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-(4-hexylphenyl)-2,2-dimethylpropan-1-one |
| SMILES | CCCCCCc1ccc(C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26O/c1-5-6-7-8-9-14-10-12-15(13-11-14)16(18)17(2,3)4/h10-13H,5-9H2,1-4H3 |
| InChIKey | UQZRPNAFGSBFOV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|