About sodium 4-decylbenzoate
sodium 4-decylbenzoate (PubChem CID 68743346) has the molecular formula C17H25NaO2
and a molecular weight of 284.38 g/mol. Its IUPAC name is sodium 4-decylbenzoate.
Molecular Properties
| Compound Name | sodium 4-decylbenzoate |
| PubChem CID | 68743346 |
| Molecular Formula | C17H25NaO2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | sodium 4-decylbenzoate |
| SMILES | CCCCCCCCCCc1ccc(C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C17H26O2.Na/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)17(18)19;/h11-14H,2-10H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | ARKZKAHOSZBYJA-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-decylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-decylbenzoate?
The IUPAC name of sodium 4-decylbenzoate (CID 68743346) is sodium 4-decylbenzoate.
What is the SMILES notation for sodium 4-decylbenzoate?
The canonical SMILES for sodium 4-decylbenzoate is CCCCCCCCCCc1ccc(C(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-decylbenzoate?
The InChIKey is ARKZKAHOSZBYJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H26O2.Na/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)17(18)19;/h11-14H,2-10H2,1H3,(H,18,19);/q;+1/p-1.
What are the key properties of sodium 4-decylbenzoate?
sodium 4-decylbenzoate has a molecular weight of 284.38 g/mol, XLogP of 0.74, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-decylbenzoate is sourced from PubChem (CID 68743346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).