About disodium;4-dodecylphthalate
disodium;4-dodecylphthalate (PubChem CID 158613546) has the molecular formula C20H28Na2O4
and a molecular weight of 378.42 g/mol. Its IUPAC name is disodium;4-dodecylphthalate.
Molecular Properties
| Compound Name | disodium;4-dodecylphthalate |
| PubChem CID | 158613546 |
| Molecular Formula | C20H28Na2O4 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | disodium;4-dodecylphthalate |
| SMILES | CCCCCCCCCCCCc1ccc(C(=O)[O-])c(C(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C20H30O4.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-16-13-14-17(19(21)22)18(15-16)20(23)24;;/h13-15H,2-12H2,1H3,(H,21,22)(H,23,24);;/q;2*+1/p-2 |
| InChIKey | HXCYSYDEONZSON-UHFFFAOYSA-L |
| XLogP | -3.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;4-dodecylphthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-dodecylphthalate?
The IUPAC name of disodium;4-dodecylphthalate (CID 158613546) is disodium;4-dodecylphthalate.
What is the SMILES notation for disodium;4-dodecylphthalate?
The canonical SMILES for disodium;4-dodecylphthalate is CCCCCCCCCCCCc1ccc(C(=O)[O-])c(C(=O)[O-])c1.[Na+].[Na+].
What is the InChIKey of disodium;4-dodecylphthalate?
The InChIKey is HXCYSYDEONZSON-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H30O4.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-16-13-14-17(19(21)22)18(15-16)20(23)24;;/h13-15H,2-12H2,1H3,(H,21,22)(H,23,24);;/q;2*+1/p-2.
What are the key properties of disodium;4-dodecylphthalate?
disodium;4-dodecylphthalate has a molecular weight of 378.42 g/mol, XLogP of -3.12, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-dodecylphthalate is sourced from PubChem (CID 158613546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).