About 3-octylbenzoate
3-octylbenzoate (PubChem CID 140615261) has the molecular formula C15H21O2-
and a molecular weight of 233.33 g/mol. Its IUPAC name is 3-octylbenzoate.
Molecular Properties
| Compound Name | 3-octylbenzoate |
| PubChem CID | 140615261 |
| Molecular Formula | C15H21O2- |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-octylbenzoate |
| SMILES | CCCCCCCCc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C15H22O2/c1-2-3-4-5-6-7-9-13-10-8-11-14(12-13)15(16)17/h8,10-12H,2-7,9H2,1H3,(H,16,17)/p-1 |
| InChIKey | HVXGXUAVMOCVHB-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octylbenzoate?
The IUPAC name of 3-octylbenzoate (CID 140615261) is 3-octylbenzoate.
What is the SMILES notation for 3-octylbenzoate?
The canonical SMILES for 3-octylbenzoate is CCCCCCCCc1cccc(C(=O)[O-])c1.
What is the InChIKey of 3-octylbenzoate?
The InChIKey is HVXGXUAVMOCVHB-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H22O2/c1-2-3-4-5-6-7-9-13-10-8-11-14(12-13)15(16)17/h8,10-12H,2-7,9H2,1H3,(H,16,17)/p-1.
What are the key properties of 3-octylbenzoate?
3-octylbenzoate has a molecular weight of 233.33 g/mol, XLogP of 2.95, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octylbenzoate is sourced from PubChem (CID 140615261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).