About acetyl 3-octylbenzoate
acetyl 3-octylbenzoate (PubChem CID 57291540) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is acetyl 3-octylbenzoate.
Molecular Properties
| Compound Name | acetyl 3-octylbenzoate |
| PubChem CID | 57291540 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | acetyl 3-octylbenzoate |
| SMILES | CCCCCCCCc1cccc(C(=O)OC(C)=O)c1 |
| InChI | InChI=1S/C17H24O3/c1-3-4-5-6-7-8-10-15-11-9-12-16(13-15)17(19)20-14(2)18/h9,11-13H,3-8,10H2,1-2H3 |
| InChIKey | YWMRHNIEBYMSMK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl 3-octylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 3-octylbenzoate?
The IUPAC name of acetyl 3-octylbenzoate (CID 57291540) is acetyl 3-octylbenzoate.
What is the SMILES notation for acetyl 3-octylbenzoate?
The canonical SMILES for acetyl 3-octylbenzoate is CCCCCCCCc1cccc(C(=O)OC(C)=O)c1.
What is the InChIKey of acetyl 3-octylbenzoate?
The InChIKey is YWMRHNIEBYMSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3/c1-3-4-5-6-7-8-10-15-11-9-12-16(13-15)17(19)20-14(2)18/h9,11-13H,3-8,10H2,1-2H3.
What are the key properties of acetyl 3-octylbenzoate?
acetyl 3-octylbenzoate has a molecular weight of 276.38 g/mol, XLogP of 4.29, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 3-octylbenzoate is sourced from PubChem (CID 57291540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).